ChemNet > CAS > 5220-49-5 3-Amino-2-cyclohexen-1-one
5220-49-5 3-Amino-2-cyclohexen-1-one
| 상품명칭 |
3-Amino-2-cyclohexen-1-one |
| 영문 이름 |
3-Amino-2-cyclohexen-1-one; 3-aminocyclohex-2-enone; 3-aminocyclohex-2-en-1-one; methyl 1-methyl-2,4,7-trioxo-1,2,3,4,7,8-hexahydropyrido[2,3-d]pyrimidine-5-carboxylate; (3E)-3-iminocyclohexanone; 3-AMINO-2-CYCLOHEXENE-1-ONE |
| 분자식 |
C6H9NO |
| 분자량 |
111.1418 |
| InChI |
InChI=1/C6H9NO/c7-5-2-1-3-6(8)4-5/h7H,1-4H2/b7-5+ |
| cas번호 |
5220-49-5 |
| EC번호 |
226-014-9 |
| 분자 구조 |
|
| 밀도 |
1.17g/cm3 |
| 비등점 |
286.5°C at 760 mmHg |
| 굴절 지수 |
1.558 |
| 인화점 |
127.1°C |
| 증기압 |
0.00263mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
