524-42-5 1,2-Naphthoquinone
상품명칭 |
1,2-Naphthoquinone |
영문 이름 |
1,2-Naphthoquinone; 1,2-Naphthalenedione; 1,2-naphthoquinone (beta); naphthalene-1,2-dione |
분자식 |
C10H6O2 |
분자량 |
158.1534 |
InChI |
InChI=1/C10H6O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H |
cas번호 |
524-42-5 |
EC번호 |
208-360-2 |
분자 구조 |
|
밀도 |
1.29g/cm3 |
녹는 점 |
136-141℃ |
비등점 |
296.1°C at 760 mmHg |
굴절 지수 |
1.617 |
인화점 |
117.4°C |
증기압 |
0.00147mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|