ChemNet > CAS > 524-95-8 Diphenylborinic acid 2-aminoethyl ester
524-95-8 Diphenylborinic acid 2-aminoethyl ester
상품명칭 |
Diphenylborinic acid 2-aminoethyl ester |
영문 이름 |
Diphenylborinic acid 2-aminoethyl ester; 2-Aminoethyl diphenylborinate; diphenylborinic acid; Diphenylboric acid 2-aminoethyl ester; B-(2-Aminoethoxy)diphenylborane; 2-APB; Diphenylboric acid ethanolamine complex |
분자식 |
C14H16BNO |
분자량 |
225.0939 |
InChI |
InChI=1/C14H16BNO/c16-11-12-17-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,16H2 |
cas번호 |
524-95-8 |
EC번호 |
208-366-5 |
분자 구조 |
|
밀도 |
1.04g/cm3 |
녹는 점 |
190-194℃ |
비등점 |
325.3°C at 760 mmHg |
굴절 지수 |
1.559 |
인화점 |
150.6°C |
증기압 |
0.000232mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|