52414-97-8 3-Bromo-2-nitrotoluene
상품명칭 |
3-Bromo-2-nitrotoluene |
영문 이름 |
3-Bromo-2-nitrotoluene; Benzene, 1-bromo-3-methyl-2-nitro-; 1-bromo-3-methyl-2-nitrobenzene; 3-Bromo-2-nitrobenzene |
분자식 |
C7H6BrNO2 |
분자량 |
216.032 |
InChI |
InChI=1/C7H6BrNO2/c1-5-3-2-4-6(8)7(5)9(10)11/h2-4H,1H3 |
cas번호 |
52414-97-8 |
분자 구조 |
|
밀도 |
1.615g/cm3 |
녹는 점 |
26.8-29℃ |
비등점 |
237.4°C at 760 mmHg |
굴절 지수 |
1.592 |
인화점 |
97.4°C |
증기압 |
0.0689mmHg at 25°C |
위험성 표시 |
T:Toxic;
|
리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
보안 규칙 |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|