ChemNet > CAS > 52516-13-9 2,4-Dichlorophenethylamine
52516-13-9 2,4-Dichlorophenethylamine
| 상품명칭 |
2,4-Dichlorophenethylamine |
| 영문 이름 |
2,4-Dichlorophenethylamine; 2-(2,4-Dichlorophenyl)-ethylamine; 2-(2,4-dichlorophenyl)ethanamine; 2-(2,4-dichlorophenyl)ethanaminium; 2,4-Dichloro-benzeneethanamine |
| 분자식 |
C8H9Cl2N |
| 분자량 |
190.0698 |
| InChI |
InChI=1/C8H9Cl2N/c1-5(11)7-3-2-6(9)4-8(7)10/h2-5H,11H2,1H3 |
| cas번호 |
52516-13-9 |
| 분자 구조 |
|
| 밀도 |
1.262g/cm3 |
| 비등점 |
256.4°C at 760 mmHg |
| 굴절 지수 |
1.566 |
| 인화점 |
108.8°C |
| 증기압 |
0.0155mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
