ChemNet > CAS > 5253-02-1 alpha-ethyl-3-nitrocinnamic acid
5253-02-1 alpha-ethyl-3-nitrocinnamic acid
상품명칭 |
alpha-ethyl-3-nitrocinnamic acid |
영문 이름 |
alpha-ethyl-3-nitrocinnamic acid;alpha-Ethyl-3-nitrocinnamic acid; 2-(3-nitrobenzylidene)butanoic acid; (2Z)-2-[(3-nitrophenyl)methylidene]butanoic acid; (2E)-2-[(3-nitrophenyl)methylidene]butanoic acid |
분자식 |
C11H11NO4 |
분자량 |
221.2093 |
InChI |
InChI=1/C11H11NO4/c1-2-9(11(13)14)6-8-4-3-5-10(7-8)12(15)16/h3-7H,2H2,1H3,(H,13,14)/b9-6+ |
cas번호 |
5253-02-1 |
EC번호 |
226-054-7 |
분자 구조 |
|
밀도 |
1.303g/cm3 |
비등점 |
381.3°C at 760 mmHg |
굴절 지수 |
1.616 |
인화점 |
164.2°C |
증기압 |
1.71E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|