526-73-8 1,2,3-Trimethylbenzene
상품명칭 |
1,2,3-Trimethylbenzene |
영문 이름 |
1,2,3-Trimethylbenzene; hemimellitene |
분자식 |
C9H12 |
분자량 |
120.19 |
InChI |
InChI=1/C9H12/c1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3 |
cas번호 |
526-73-8 |
EC번호 |
208-394-8 |
분자 구조 |
|
밀도 |
0.894 |
녹는 점 |
-25℃ |
비등점 |
175-176℃ |
굴절 지수 |
1.513 |
인화점 |
53℃ |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R10:;
R37:;
|
보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|