ChemNet > CAS > 52727-57-8 Methyl 2-amino-5-bromobenzoate
52727-57-8 Methyl 2-amino-5-bromobenzoate
상품명칭 |
Methyl 2-amino-5-bromobenzoate |
영문 이름 |
Methyl 2-amino-5-bromobenzoate; 2-Amino-5-bromobenzoic acid methyl ester; 5-Bromoanthranilic acid methyl ester |
분자식 |
C8H8BrNO2 |
분자량 |
230.0586 |
InChI |
InChI=1/C8H8BrNO2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,10H2,1H3 |
cas번호 |
52727-57-8 |
분자 구조 |
|
밀도 |
1.578g/cm3 |
녹는 점 |
72-74℃ |
비등점 |
286.3°C at 760 mmHg |
굴절 지수 |
1.601 |
인화점 |
126.9°C |
증기압 |
0.00266mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|