ChemNet > CAS > 5279-32-3 1,2-Dibromo-4,5-(methylenedioxy)benzene
5279-32-3 1,2-Dibromo-4,5-(methylenedioxy)benzene
상품명칭 |
1,2-Dibromo-4,5-(methylenedioxy)benzene |
영문 이름 |
1,2-Dibromo-4,5-(methylenedioxy)benzene; 5,6-Dibromo-1,3-benzodioxole; 4,5-Methylenedioxy-1,2-dibromobenzene; 5,6-dibromo-1,3-benzodioxole; 1,2-Dibromo-4,5-(methylenedioxy) benzene; 3-(trifluoromethyl)sulphanylaniline |
분자식 |
C7H4Br2O2 |
분자량 |
279.9135 |
InChI |
InChI=1/C7H4Br2O2/c8-4-1-6-7(2-5(4)9)11-3-10-6/h1-2H,3H2 |
cas번호 |
5279-32-3 |
분자 구조 |
|
밀도 |
2.104g/cm3 |
비등점 |
294.7°C at 760 mmHg |
굴절 지수 |
1.638 |
인화점 |
118.1°C |
증기압 |
0.00281mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|