상품명칭 |
5,6,7,8-Tetrahydro-1-naphthol |
영문 이름 |
5,6,7,8-Tetrahydro-1-naphthol; 5,6,7,8-Tetrahydro-alpha-naphthol; 5-Hydroxytetralin; NSC 28822; Tetrahydro-alpha-naphthol; 1-Naphthalenol, 5,6,7,8-tetrahydro-; 1-Naphthol, 5,6,7,8-tetrahydro-; 5,6,7,8-tetrahydronaphthalen-1-ol |
분자식 |
C10H12O |
분자량 |
148.2017 |
InChI |
InChI=1/C10H12O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h3,5,7,11H,1-2,4,6H2 |
cas번호 |
529-35-1 |
EC번호 |
208-461-1 |
분자 구조 |
|
밀도 |
1.1g/cm3 |
녹는 점 |
67-71℃ |
비등점 |
268.2°C at 760 mmHg |
굴절 지수 |
1.581 |
인화점 |
122.6°C |
증기압 |
0.00473mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|