ChemNet > CAS > 5323-87-5 3-Ethoxy-2-cyclohexen-1-one
5323-87-5 3-Ethoxy-2-cyclohexen-1-one
상품명칭 |
3-Ethoxy-2-cyclohexen-1-one |
영문 이름 |
3-Ethoxy-2-cyclohexen-1-one; 3-Ethoxy-2-cyclohexene-1-one; 3-ethoxycyclohex-2-en-1-one |
분자식 |
C8H12O2 |
분자량 |
140.1797 |
InChI |
InChI=1/C8H12O2/c1-2-10-8-5-3-4-7(9)6-8/h6H,2-5H2,1H3 |
cas번호 |
5323-87-5 |
EC번호 |
226-190-7 |
분자 구조 |
|
밀도 |
1g/cm3 |
비등점 |
250.1°C at 760 mmHg |
굴절 지수 |
1.467 |
인화점 |
107.2°C |
증기압 |
0.022mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|