53293-00-8 5-Hexynoic acid
상품명칭 |
5-Hexynoic acid |
영문 이름 |
5-Hexynoic acid; Hex-5-ynoic acid; hex-5-ynoate |
분자식 |
C6H7O2 |
분자량 |
111.1191 |
InChI |
InChI=1/C6H8O2/c1-2-3-4-5-6(7)8/h1H,3-5H2,(H,7,8)/p-1 |
cas번호 |
53293-00-8 |
분자 구조 |
|
비등점 |
220.6°C at 760 mmHg |
인화점 |
99.6°C |
증기압 |
0.042mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|