5332-96-7 4-Nitrophenylacetone
상품명칭 |
4-Nitrophenylacetone |
영문 이름 |
4-Nitrophenylacetone; 1-(4-Nitrophenyl)-2-propanone; 1-(4-nitrophenyl)propan-2-one |
분자식 |
C9H9NO3 |
분자량 |
179.1727 |
InChI |
InChI=1/C9H9NO3/c1-7(11)6-8-2-4-9(5-3-8)10(12)13/h2-5H,6H2,1H3 |
cas번호 |
5332-96-7 |
분자 구조 |
|
밀도 |
1.212g/cm3 |
녹는 점 |
63-64℃ |
비등점 |
307.5°C at 760 mmHg |
굴절 지수 |
1.549 |
인화점 |
146.4°C |
증기압 |
0.000724mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|