ChemNet > CAS > 53633-54-8 Polyquaternium-11
53633-54-8 Polyquaternium-11
| 상품명칭 |
Polyquaternium-11 |
| 영문 이름 |
Polyquaternium-11; Poly(N-vinylpyrrolidone 2-dimethylaminoethyl methacrylate) diethyl sulfate; N,N-Dimethylaminoethyl methacrylate-vinylpyrrolidone copolymer diethyl sulfate salt; 2-dimethylaminoethyl 2-methylprop-2-enoate; 1-vinylpyrrolidin-2-one; Quaternized copolymer of vinylpyrrolidone and dimethylaminoethyl methacrylate |
| 분자식 |
C18H34N2O7S |
| 분자량 |
422.5368 |
| InChI |
InChI=1/C8H15NO2.C6H9NO.C4H10O4S/c1-7(2)8(10)11-6-5-9(3)4;1-2-7-5-3-4-6(7)8;1-3-7-9(5,6)8-4-2/h1,5-6H2,2-4H3;2H,1,3-5H2;3-4H2,1-2H3 |
| cas번호 |
53633-54-8 |
| 분자 구조 |
|
| 비등점 |
187°C at 760 mmHg |
| 인화점 |
70.6°C |
| 증기압 |
0.644mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
|
|
