ChemNet > CAS > 53760-27-3 4,4'-Diaminodiphenylamine sulfate
53760-27-3 4,4'-Diaminodiphenylamine sulfate
| 상품명칭 |
4,4'-Diaminodiphenylamine sulfate |
| 영문 이름 |
4,4'-Diaminodiphenylamine sulfate; 4,4-Diaminophenylamine sulfate; 4,4-Iminodianiline sulfate salt; N-(4-aminophenyl)benzene-1,4-diamine; N-(4-aminophenyl)benzene-1,4-diamine sulfate (1:1); N-(4-Aminophenyl)-1,4-benzenediamine |
| 분자식 |
C12H13N3O4S |
| 분자량 |
295.3154 |
| InChI |
InChI=1/C12H13N3.H2O4S/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;1-5(2,3)4/h1-8,15H,13-14H2;(H2,1,2,3,4)/p-2 |
| cas번호 |
53760-27-3 |
| EC번호 |
258-748-0 |
| 분자 구조 |
|
| 녹는 점 |
300℃ |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
