ChemNet > CAS > 538-62-5 Phenylazoformic acid 2-phenylhydrazide
538-62-5 Phenylazoformic acid 2-phenylhydrazide
상품명칭 |
Phenylazoformic acid 2-phenylhydrazide |
영문 이름 |
Phenylazoformic acid 2-phenylhydrazide; SYM-DIPHENYLCARBAZONE; (E)-N',2-diphenyldiazenecarbohydrazide; Diphenylcarbazone; Diphenyl carbazone |
분자식 |
C13H12N4O |
분자량 |
240.2606 |
InChI |
InChI=1/C13H12N4O/c18-13(16-14-11-7-3-1-4-8-11)17-15-12-9-5-2-6-10-12/h1-10,14H,(H,16,18)/b17-15- |
cas번호 |
538-62-5 |
EC번호 |
208-698-0 |
분자 구조 |
|
녹는 점 |
153-157℃ |
굴절 지수 |
1.617 |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|