ChemNet > CAS > 5381-99-7 2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one
5381-99-7 2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one
| 상품명칭 |
2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one |
| 영문 이름 |
2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one; 2-Chloro-1,3,2-benzodioxaphosphorin-4-one; ChloroHbenzodioxaphosphorinone; 2-chloro-4H-1,3,2-benzodioxaphosphinin-4-one |
| 분자식 |
C7H4ClO3P |
| 분자량 |
202.5316 |
| InChI |
InChI=1/C7H4ClO3P/c8-12-10-6-4-2-1-3-5(6)7(9)11-12/h1-4H |
| cas번호 |
5381-99-7 |
| 분자 구조 |
|
| 녹는 점 |
36-128℃ |
| 비등점 |
257.8°C at 760 mmHg |
| 인화점 |
109.7°C |
| 증기압 |
0.0142mmHg at 25°C |
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R14:Reacts violently with water.;
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S8:Keep container dry.;
|
|
