ChemNet > CAS > 5391-30-0 2-Bromophenylthiourea
5391-30-0 2-Bromophenylthiourea
| 상품명칭 |
2-Bromophenylthiourea |
| 영문 이름 |
2-Bromophenylthiourea;Thiourea, (2-bromophenyl)-; 1-(2-bromophenyl)thiourea |
| 분자식 |
C7H7BrN2S |
| 분자량 |
231.1129 |
| InChI |
InChI=1/C7H7BrN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
| cas번호 |
5391-30-0 |
| 분자 구조 |
|
| 밀도 |
1.728g/cm3 |
| 비등점 |
314.2°C at 760 mmHg |
| 굴절 지수 |
1.748 |
| 인화점 |
143.8°C |
| 증기압 |
0.000474mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R25:Toxic if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
