ChemNet > CAS > 5393-99-7 4,5-Diphenyl-1,2,3-thiadiazole
5393-99-7 4,5-Diphenyl-1,2,3-thiadiazole
상품명칭 |
4,5-Diphenyl-1,2,3-thiadiazole |
영문 이름 |
4,5-Diphenyl-1,2,3-thiadiazole; |
분자식 |
C14H10N2S |
분자량 |
238.3076 |
InChI |
InChI=1/C14H10N2S/c1-3-7-11(8-4-1)13-14(17-16-15-13)12-9-5-2-6-10-12/h1-10H |
cas번호 |
5393-99-7 |
분자 구조 |
|
밀도 |
1.216g/cm3 |
비등점 |
361.2°C at 760 mmHg |
굴절 지수 |
1.633 |
인화점 |
161.9°C |
증기압 |
4.38E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|