5395-04-0 Bis(pentamethylene)urea
상품명칭 |
Bis(pentamethylene)urea |
영문 이름 |
Bis(pentamethylene)urea; 1,1-Carbonyldipiperidine; dipiperidin-1-ylmethanone |
분자식 |
C11H20N2O |
분자량 |
196.2893 |
InChI |
InChI=1/C11H20N2O/c14-11(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H2 |
cas번호 |
5395-04-0 |
EC번호 |
226-407-5 |
분자 구조 |
|
밀도 |
1.076g/cm3 |
녹는 점 |
44-47℃ |
비등점 |
297°C at 760 mmHg |
굴절 지수 |
1.524 |
인화점 |
119.1°C |
증기압 |
0.00139mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|