ChemNet > CAS > 5400-81-7 ethyl 4-amino-3,5-diiodobenzoate
5400-81-7 ethyl 4-amino-3,5-diiodobenzoate
상품명칭 |
ethyl 4-amino-3,5-diiodobenzoate |
영문 이름 |
ethyl 4-amino-3,5-diiodobenzoate; |
분자식 |
C9H9I2NO2 |
분자량 |
416.9822 |
InChI |
InChI=1/C9H9I2NO2/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4H,2,12H2,1H3 |
cas번호 |
5400-81-7 |
분자 구조 |
|
밀도 |
2.191g/cm3 |
녹는 점 |
148℃ |
비등점 |
449.1°C at 760 mmHg |
굴절 지수 |
1.689 |
인화점 |
225.4°C |
증기압 |
2.93E-08mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|