ChemNet > CAS > 5407-98-7 cyclobutyl phenyl ketone
5407-98-7 cyclobutyl phenyl ketone
| 상품명칭 |
cyclobutyl phenyl ketone |
| 영문 이름 |
cyclobutyl phenyl ketone; Benzoylcyclobutane; cyclobutyl(phenyl)methanone |
| 분자식 |
C11H12O |
| 분자량 |
160.2124 |
| InChI |
InChI=1/C11H12O/c12-11(10-7-4-8-10)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2 |
| cas번호 |
5407-98-7 |
| EC번호 |
226-473-5 |
| 분자 구조 |
|
| 밀도 |
1.082g/cm3 |
| 비등점 |
260°C at 760 mmHg |
| 굴절 지수 |
1.563 |
| 인화점 |
102.5°C |
| 증기압 |
0.0125mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
