ChemNet > CAS > 5422-88-8 Cyclopentyl phenyl ketone
5422-88-8 Cyclopentyl phenyl ketone
상품명칭 |
Cyclopentyl phenyl ketone |
영문 이름 |
Cyclopentyl phenyl ketone; Benzoylcyclopentane; cyclopentyl(phenyl)methanone |
분자식 |
C12H14O |
분자량 |
174.239 |
InChI |
InChI=1/C12H14O/c13-12(11-8-4-5-9-11)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2 |
cas번호 |
5422-88-8 |
EC번호 |
226-548-2 |
분자 구조 |
|
밀도 |
1.051g/cm3 |
비등점 |
273.9°C at 760 mmHg |
굴절 지수 |
1.548 |
인화점 |
112.4°C |
증기압 |
0.00556mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|