5445-22-7 Methyl 2-bromooctanoate
상품명칭 |
Methyl 2-bromooctanoate |
영문 이름 |
Methyl 2-bromooctanoate; 2-Bromooctanoic acid methyl ester; 2-bromo-octanoicacimethylester; Methyl2-bromooctanoate,99+% |
분자식 |
C9H17BrO2 |
분자량 |
237.1341 |
InChI |
InChI=1/C9H17BrO2/c1-3-4-5-6-7-8(10)9(11)12-2/h8H,3-7H2,1-2H3 |
cas번호 |
5445-22-7 |
EC번호 |
226-644-4 |
분자 구조 |
|
밀도 |
1.221g/cm3 |
비등점 |
227.7°C at 760 mmHg |
굴절 지수 |
1.46 |
인화점 |
101.9°C |
증기압 |
0.0763mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|