ChemNet > CAS > 54509-71-6 1-Iodo-2,3,4,5-tetramethylbenzene
54509-71-6 1-Iodo-2,3,4,5-tetramethylbenzene
상품명칭 |
1-Iodo-2,3,4,5-tetramethylbenzene |
영문 이름 |
1-Iodo-2,3,4,5-tetramethylbenzene; 2,3,4,5-Tetramethyliodobenzene |
분자식 |
C10H13I |
분자량 |
260.1147 |
InChI |
InChI=1/C10H13I/c1-6-5-10(11)9(4)8(3)7(6)2/h5H,1-4H3 |
cas번호 |
54509-71-6 |
분자 구조 |
|
밀도 |
1.472g/cm3 |
녹는 점 |
30℃ |
비등점 |
278.1°C at 760 mmHg |
굴절 지수 |
1.576 |
인화점 |
124°C |
증기압 |
0.00733mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|