ChemNet > CAS > 54679-16-2 4-(chloromethyl)-2-(2-thienyl)-1,3-thiazole
54679-16-2 4-(chloromethyl)-2-(2-thienyl)-1,3-thiazole
상품명칭 |
4-(chloromethyl)-2-(2-thienyl)-1,3-thiazole |
영문 이름 |
4-(chloromethyl)-2-(2-thienyl)-1,3-thiazole;4-(chloromethyl)-2-(thiophen-2-yl)-1,3-thiazole |
분자식 |
C8H6ClNS2 |
분자량 |
215.7229 |
InChI |
InChI=1/C8H6ClNS2/c9-4-6-5-12-8(10-6)7-2-1-3-11-7/h1-3,5H,4H2 |
cas번호 |
54679-16-2 |
분자 구조 |
|
밀도 |
1.395g/cm3 |
녹는 점 |
51℃ |
비등점 |
362°C at 760 mmHg |
굴절 지수 |
1.636 |
인화점 |
172.7°C |
증기압 |
4.15E-05mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|