ChemNet > CAS > 548-39-0 Perinaphthenone
548-39-0 Perinaphthenone
| 상품명칭 |
Perinaphthenone |
| 영문 이름 |
Perinaphthenone; phenalen-1-one; Perinaphthalenone; 1H-phenalen-1-one |
| 분자식 |
C13H8O |
| 분자량 |
180.202 |
| InChI |
InChI=1/C13H8O/c14-12-8-7-10-4-1-3-9-5-2-6-11(12)13(9)10/h1-8H |
| cas번호 |
548-39-0 |
| EC번호 |
208-945-2 |
| 분자 구조 |
|
| 밀도 |
1.265g/cm3 |
| 녹는 점 |
149-154℃ |
| 비등점 |
355.2°C at 760 mmHg |
| 굴절 지수 |
1.715 |
| 인화점 |
157.9°C |
| 증기압 |
3.18E-05mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
