ChemNet > CAS > 54932-72-8 5-Bromo-2-chlorotoluene
54932-72-8 5-Bromo-2-chlorotoluene
상품명칭 |
5-Bromo-2-chlorotoluene |
영문 이름 |
5-Bromo-2-chlorotoluene; 4-bromo-1-chloro-2-methylbenzene |
분자식 |
C7H6BrCl |
분자량 |
205.4795 |
InChI |
InChI=1/C7H6BrCl/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
cas번호 |
54932-72-8 |
분자 구조 |
|
밀도 |
1.535g/cm3 |
비등점 |
216.9°C at 760 mmHg |
굴절 지수 |
1.566 |
인화점 |
99.1°C |
증기압 |
0.2mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|