ChemNet > CAS > 551-72-4 L-chiro-Inositol
551-72-4 L-chiro-Inositol
| 상품명칭 |
L-chiro-Inositol |
| 영문 이름 |
L-chiro-Inositol; 1L-chiro-inositol; (1R,2R,3R,4R,5S,6S)-cyclohexane-1,2,3,4,5,6-hexol |
| 분자식 |
C6H12O6 |
| 분자량 |
180.1559 |
| InChI |
InChI=1/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4-,5+,6+/m1/s1 |
| cas번호 |
551-72-4 |
| EC번호 |
209-000-7 |
| 분자 구조 |
|
| 밀도 |
2.039g/cm3 |
| 녹는 점 |
230℃ |
| 비등점 |
291.326°C at 760 mmHg |
| 굴절 지수 |
1.784 |
| 인화점 |
143.387°C |
| 증기압 |
0mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
