551-72-4 L-chiro-Inositol
상품명칭 |
L-chiro-Inositol |
영문 이름 |
L-chiro-Inositol; 1L-chiro-inositol; (1R,2R,3R,4R,5S,6S)-cyclohexane-1,2,3,4,5,6-hexol |
분자식 |
C6H12O6 |
분자량 |
180.1559 |
InChI |
InChI=1/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4-,5+,6+/m1/s1 |
cas번호 |
551-72-4 |
EC번호 |
209-000-7 |
분자 구조 |
|
밀도 |
2.039g/cm3 |
녹는 점 |
230℃ |
비등점 |
291.326°C at 760 mmHg |
굴절 지수 |
1.784 |
인화점 |
143.387°C |
증기압 |
0mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|