552-32-9 2-Nitroacetanilide
상품명칭 |
2-Nitroacetanilide |
영문 이름 |
2-Nitroacetanilide;o-Nitroacetanilide; 2'-Nitroacetanilide; AI3-08843; NSC 1313; Acetamide, N-(2-nitrophenyl)-; Acetanilide, 2'-nitro- (8CI); N-(2-nitrophenyl)acetamide |
분자식 |
C8H8N2O3 |
분자량 |
180.1607 |
InChI |
InChI=1/C8H8N2O3/c1-6(11)9-7-4-2-3-5-8(7)10(12)13/h2-5H,1H3,(H,9,11) |
cas번호 |
552-32-9 |
EC번호 |
209-009-6 |
분자 구조 |
|
밀도 |
1.34g/cm3 |
녹는 점 |
92-94℃ |
비등점 |
388.1°C at 760 mmHg |
굴절 지수 |
1.617 |
인화점 |
188.5°C |
증기압 |
3.14E-06mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|