ChemNet > CAS > 5520-66-1 p-Diethylaminoacetophenone
5520-66-1 p-Diethylaminoacetophenone
| 상품명칭 |
p-Diethylaminoacetophenone |
| 영문 이름 |
p-Diethylaminoacetophenone; 4-Diethylaminoacetophenone; 1-[4-(diethylamino)phenyl]ethanone |
| 분자식 |
C12H17NO |
| 분자량 |
191.2695 |
| InChI |
InChI=1/C12H17NO/c1-4-13(5-2)12-8-6-11(7-9-12)10(3)14/h6-9H,4-5H2,1-3H3 |
| cas번호 |
5520-66-1 |
| 분자 구조 |
|
| 밀도 |
0.996g/cm3 |
| 비등점 |
313.9°C at 760 mmHg |
| 굴절 지수 |
1.536 |
| 인화점 |
114.4°C |
| 증기압 |
0.000482mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
