ChemNet > CAS > 55259-49-9 Tetramethyltetraselenafulvalene
55259-49-9 Tetramethyltetraselenafulvalene
| 상품명칭 |
Tetramethyltetraselenafulvalene |
| 영문 이름 |
Tetramethyltetraselenafulvalene; |
| 분자식 |
C10H12Se4 |
| 분자량 |
448.0423 |
| InChI |
InChI=1/C10H12Se4/c1-5-6(2)12-9(11-5)10-13-7(3)8(4)14-10/h1-4H3 |
| cas번호 |
55259-49-9 |
| 분자 구조 |
|
| 녹는 점 |
265-270℃ |
| 비등점 |
338.8°C at 760 mmHg |
| 인화점 |
158.7°C |
| 증기압 |
0.000188mmHg at 25°C |
| 위험성 표시 |
 T:Toxic;
|
| 리스크 규칙 |
R23/25:Toxic by inhalation and if swallowed.;
R33:Danger of cummulative effects.;
|
| 보안 규칙 |
S20/21:When using do not eat, drink or smoke.;
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
