ChemNet > CAS > 553-17-3 bis(2-methoxyphenyl) carbonate
553-17-3 bis(2-methoxyphenyl) carbonate
상품명칭 |
bis(2-methoxyphenyl) carbonate |
영문 이름 |
bis(2-methoxyphenyl) carbonate; diguaiacyl carbonate; guaiacyl carbonate; Guaiacol carbonate |
분자식 |
C15H14O5 |
분자량 |
274.2687 |
InChI |
InChI=1/C15H14O5/c1-17-11-7-3-5-9-13(11)19-15(16)20-14-10-6-4-8-12(14)18-2/h3-10H,1-2H3 |
cas번호 |
553-17-3 |
EC번호 |
209-034-2 |
분자 구조 |
|
밀도 |
1.208g/cm3 |
비등점 |
392.6°C at 760 mmHg |
굴절 지수 |
1.552 |
인화점 |
173.7°C |
증기압 |
2.27E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|