5536-61-8 Sodium methacrylate
상품명칭 |
Sodium methacrylate |
영문 이름 |
Sodium methacrylate; Methacrylic acid sodium salt |
분자식 |
C4H5NaO2 |
분자량 |
108.07 |
InChI |
InChI=1/C4H6O2.Na/c1-3(2)4(5)6;/h1H2,2H3,(H,5,6);/q;+1/p-1 |
cas번호 |
5536-61-8 |
EC번호 |
226-896-5 |
분자 구조 |
|
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|