ChemNet > CAS > 5541-89-9 4-(1H-indol-3-yl)butan-2-one
5541-89-9 4-(1H-indol-3-yl)butan-2-one
상품명칭 |
4-(1H-indol-3-yl)butan-2-one |
영문 이름 |
4-(1H-indol-3-yl)butan-2-one; |
분자식 |
C12H13NO |
분자량 |
187.2377 |
InChI |
InChI=1/C12H13NO/c1-9(14)6-7-10-8-13-12-5-3-2-4-11(10)12/h2-5,8,13H,6-7H2,1H3 |
cas번호 |
5541-89-9 |
분자 구조 |
|
밀도 |
1.136g/cm3 |
녹는 점 |
85℃ |
비등점 |
356.1°C at 760 mmHg |
굴절 지수 |
1.613 |
인화점 |
177°C |
증기압 |
2.98E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|