ChemNet > CAS > 5570-18-3 (2-Aminophenyl)boronic acid
5570-18-3 (2-Aminophenyl)boronic acid
상품명칭 |
(2-Aminophenyl)boronic acid |
영문 이름 |
(2-Aminophenyl)boronic acid; 2-Aminophenylboronic acid; N'-[(1Z)-(2,5-dimethoxyphenyl)methylidene]-2-[(4-methylphenyl)amino]acetohydrazide (non-preferred name); 2-Aminophenylboronic Acid Hcl |
분자식 |
C18H21N3O3 |
분자량 |
327.3776 |
InChI |
InChI=1/C18H21N3O3/c1-13-4-6-15(7-5-13)19-12-18(22)21-20-11-14-10-16(23-2)8-9-17(14)24-3/h4-11,19H,12H2,1-3H3,(H,21,22)/b20-11- |
cas번호 |
5570-18-3 |
분자 구조 |
|
밀도 |
1.14g/cm3 |
굴절 지수 |
1.558 |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|