ChemNet > CAS > 55776-17-5 2,6-Dimethoxy-3-nitrobenzoic acid
55776-17-5 2,6-Dimethoxy-3-nitrobenzoic acid
상품명칭 |
2,6-Dimethoxy-3-nitrobenzoic acid |
영문 이름 |
2,6-Dimethoxy-3-nitrobenzoic acid; |
분자식 |
C9H9NO6 |
분자량 |
227.1709 |
InChI |
InChI=1/C9H9NO6/c1-15-6-4-3-5(10(13)14)8(16-2)7(6)9(11)12/h3-4H,1-2H3,(H,11,12) |
cas번호 |
55776-17-5 |
EC번호 |
259-814-1 |
분자 구조 |
|
밀도 |
1.403g/cm3 |
비등점 |
420.7°C at 760 mmHg |
굴절 지수 |
1.569 |
인화점 |
208.2°C |
증기압 |
7.92E-08mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|