55836-71-0 4-ethoxybenzamide
상품명칭 |
4-ethoxybenzamide |
영문 이름 |
4-ethoxybenzamide; p-Ethoxybenzamide; 4-ethoxy benzamide |
분자식 |
C9H11NO2 |
분자량 |
165.1891 |
InChI |
InChI=1/C9H11NO2/c1-2-12-8-5-3-7(4-6-8)9(10)11/h3-6H,2H2,1H3,(H2,10,11) |
cas번호 |
55836-71-0 |
EC번호 |
259-847-1 |
분자 구조 |
|
밀도 |
1.111g/cm3 |
녹는 점 |
208-210℃ |
비등점 |
307.7°C at 760 mmHg |
굴절 지수 |
1.538 |
인화점 |
159°C |
증기압 |
0.000714mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|