ChemNet > CAS > 5585-33-1 2-(4-Morpholino)aniline
5585-33-1 2-(4-Morpholino)aniline
| 상품명칭 |
2-(4-Morpholino)aniline |
| 영문 이름 |
2-(4-Morpholino)aniline; 4-(2-Aminophenyl)morpholine; 2-(morpholin-4-yl)aniline; 2-morpholinoaniline |
| 분자식 |
C10H14N2O |
| 분자량 |
178.231 |
| InChI |
InChI=1/C10H14N2O/c11-9-3-1-2-4-10(9)12-5-7-13-8-6-12/h1-4H,5-8,11H2 |
| cas번호 |
5585-33-1 |
| 분자 구조 |
|
| 밀도 |
1.149g/cm3 |
| 녹는 점 |
93℃ |
| 비등점 |
332.5°C at 760 mmHg |
| 굴절 지수 |
1.589 |
| 인화점 |
154.9°C |
| 증기압 |
0.000146mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
