| 상품명칭 |
3,7-디하이드로-1,3-디메틸-1H-퓨린-2,6-디온, 1-아미노프로판-2-올(1:1)과 화합물 |
| 별명 |
테오필린 이소프로판올아민; 3,7-디하이드로-1,3-디메틸-1H-퓨린-2,6-디온, 1-아미노프로판-2-올(1:1)과 화합물; 1,3- 디메틸 -3,7- 디 하이드로 -1H- 퓨린 -2,6- 디온; 1,3- 디메틸 -3,7- 디 하이드로 -1H- 퓨린 -2,6- 디온 - 1- 아미노 프로판 -2- 올 (1 : 1) |
| 영문 이름 |
3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 1-aminopropan-2-ol (1:1);Theophylline isopropanolamine; 3,7-Dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 1-aminopropan-2-ol (1:1); 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione; 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - 1-aminopropan-2-ol (1:1) |
| 분자식 |
C10H17N5O3 |
| 분자량 |
255.2737 |
| InChI |
InChI=1/C7H8N4O2.C3H9NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;1-3(5)2-4/h3H,1-2H3,(H,8,9);3,5H,2,4H2,1H3 |
| cas번호 |
5600-19-1 |
| EC번호 |
227-017-8 |
| 분자 구조 |
|
| 비등점 |
454.1°C at 760 mmHg |
| 인화점 |
228.4°C |
| 증기압 |
1.96E-08mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
|
|
