ChemNet > CAS > 56041-57-7 2,3-Dichloroacetophenone
56041-57-7 2,3-Dichloroacetophenone
상품명칭 |
2,3-Dichloroacetophenone |
영문 이름 |
2,3-Dichloroacetophenone; 1-(2,3-Dichlorophenyl)ethan-1-one; 1-(2,3-dichlorophenyl)ethanone |
분자식 |
C8H6Cl2O |
분자량 |
189.0386 |
InChI |
InChI=1/C8H6Cl2O/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,1H3 |
cas번호 |
56041-57-7 |
EC번호 |
259-954-3 |
분자 구조 |
|
밀도 |
1.304g/cm3 |
녹는 점 |
106℃ |
비등점 |
247.3°C at 760 mmHg |
굴절 지수 |
1.548 |
인화점 |
101.3°C |
증기압 |
0.0258mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|