ChemNet > CAS > 56136-84-6 4,5-Methylenedioxy-2-nitroacetophenone
56136-84-6 4,5-Methylenedioxy-2-nitroacetophenone
상품명칭 |
4,5-Methylenedioxy-2-nitroacetophenone |
영문 이름 |
4,5-Methylenedioxy-2-nitroacetophenone; 1-(6-Nitro-1,3-benzodioxol-5-yl)ethanone; 4',5'-Methylenedioxy-2'-nitroacetophenone |
분자식 |
C9H7NO5 |
분자량 |
209.1556 |
InChI |
InChI=1/C9H7NO5/c1-5(11)6-2-8-9(15-4-14-8)3-7(6)10(12)13/h2-3H,4H2,1H3 |
cas번호 |
56136-84-6 |
EC번호 |
260-010-8 |
분자 구조 |
|
밀도 |
1.452g/cm3 |
비등점 |
392.4°C at 760 mmHg |
굴절 지수 |
1.595 |
인화점 |
202.5°C |
증기압 |
2.29E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|