ChemNet > CAS > 56341-36-7 1,5-Dimethyl-2-pyrrolecarbonitrile
56341-36-7 1,5-Dimethyl-2-pyrrolecarbonitrile
상품명칭 |
1,5-Dimethyl-2-pyrrolecarbonitrile |
영문 이름 |
1,5-Dimethyl-2-pyrrolecarbonitrile; 1,5-Dimethylpyrrole-2-carbonitrile; 1,5-dimethyl-1H-pyrrole-2-carbonitrile; 1,2-Dimethyl-5-cyanopyrrole |
분자식 |
C7H8N2 |
분자량 |
120.1518 |
InChI |
InChI=1/C7H8N2/c1-6-3-4-7(5-8)9(6)2/h3-4H,1-2H3 |
cas번호 |
56341-36-7 |
EC번호 |
260-120-6 |
분자 구조 |
|
밀도 |
0.98g/cm3 |
녹는 점 |
53-56℃ |
비등점 |
238.9°C at 760 mmHg |
굴절 지수 |
1.529 |
인화점 |
104.4°C |
증기압 |
0.0414mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21:Harmful by inhalation and in contact with skin.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|