565-68-4 4-methylpentyn-3-ol
상품명칭 |
4-methylpentyn-3-ol |
영문 이름 |
4-methylpentyn-3-ol; 1-Isopropylpropargyl alcohol; 1-pentyn-3-ol, 4-methyl-; 4-Methyl-1-pentyne-3-ol; 4-Methylpent-1-yn-3-ol |
분자식 |
C6H10O |
분자량 |
98.143 |
InChI |
InChI=1/C6H10O/c1-4-6(7)5(2)3/h1,5-7H,2-3H3 |
cas번호 |
565-68-4 |
EC번호 |
209-287-9 |
분자 구조 |
|
밀도 |
0.895g/cm3 |
비등점 |
139.3°C at 760 mmHg |
굴절 지수 |
1.444 |
인화점 |
41.9°C |
증기압 |
2.69mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|