ChemNet > CAS > 56962-08-4 4,5-Dichlorophthalic acid
56962-08-4 4,5-Dichlorophthalic acid
| 상품명칭 |
4,5-Dichlorophthalic acid |
| 영문 이름 |
4,5-Dichlorophthalic acid;1,2-Benzenedicarboxylic acid, 4,5-dichloro-; 4,5-dichlorobenzene-1,2-dicarboxylic acid |
| 분자식 |
C8H4Cl2O4 |
| 분자량 |
235.021 |
| InChI |
InChI=1/C8H4Cl2O4/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h1-2H,(H,11,12)(H,13,14) |
| cas번호 |
56962-08-4 |
| EC번호 |
260-478-3 |
| 분자 구조 |
|
| 밀도 |
1.698g/cm3 |
| 녹는 점 |
193-195℃ |
| 비등점 |
422.1°C at 760 mmHg |
| 굴절 지수 |
1.64 |
| 인화점 |
209.1°C |
| 증기압 |
7.05E-08mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
