ChemNet > CAS > 570-02-5 2,4,6-Trimethoxybenzoic acid
570-02-5 2,4,6-Trimethoxybenzoic acid
| 상품명칭 |
2,4,6-Trimethoxybenzoic acid |
| 영문 이름 |
2,4,6-Trimethoxybenzoic acid;Benzoic acid, 2,4,6-trimethoxy- |
| 분자식 |
C10H12O5 |
| 분자량 |
212.1993 |
| InChI |
InChI=1/C10H12O5/c1-13-6-4-7(14-2)9(10(11)12)8(5-6)15-3/h4-5H,1-3H3,(H,11,12) |
| cas번호 |
570-02-5 |
| EC번호 |
209-325-4 |
| 분자 구조 |
|
| 밀도 |
1.219g/cm3 |
| 비등점 |
350.6°C at 760 mmHg |
| 굴절 지수 |
1.523 |
| 인화점 |
137.4°C |
| 증기압 |
1.62E-05mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
