570-08-1 Diethyl acetylmalonate

상품명칭	Diethyl acetylmalonate
영문 이름	Diethyl acetylmalonate; Acetylmalonic acid diethyl ester; (2-ethylbutanoyl)propanedioate
분자식	C₉H₁₂O₅
분자량	200.1897
InChI	InChI=1/C9H14O5/c1-3-5(4-2)7(10)6(8(11)12)9(13)14/h5-6H,3-4H2,1-2H3,(H,11,12)(H,13,14)/p-2
cas번호	570-08-1
분자 구조
비등점	372.3°C at 760 mmHg
인화점	193.1°C
증기압	1.45E-06mmHg at 25°C
위험성 표시
리스크 규칙	R36/38:Irritating to eyes and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;