ChemNet > CAS > 5720-05-8 4-Methylbenzeneboronic acid
5720-05-8;917814-66-5 4-Methylbenzeneboronic acid
상품명칭 |
4-Methylbenzeneboronic acid |
영문 이름 |
4-Methylbenzeneboronic acid; AKOS BRN-0019; 4-Tolylboronic Acid; 4-Tolyboronic Acid; 4-Methylphenylboric Acid; 4-Methylphenylboronic Acid; P-Methylphenylboronic Acid; P-Tolylboronic Acid; (4-Methylphenyl)Boronic Acid; (1R)-N-Methyl-1-Phenylethanamine |
분자식 |
C9H13N |
분자량 |
135.2062 |
InChI |
InChI=1/C9H13N/c1-8(10-2)9-6-4-3-5-7-9/h3-8,10H,1-2H3/t8-/m1/s1 |
cas번호 |
5720-05-8;917814-66-5 |
분자 구조 |
|
밀도 |
0.911g/cm3 |
녹는 점 |
256-263℃ |
비등점 |
178.7°C at 760 mmHg |
굴절 지수 |
1.505 |
인화점 |
61.6°C |
증기압 |
0.976mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|