ChemNet > CAS > 573-03-5 4-fluoro-1-naphthoic acid
573-03-5 4-fluoro-1-naphthoic acid
상품명칭 |
4-fluoro-1-naphthoic acid |
영문 이름 |
4-fluoro-1-naphthoic acid;4-Fluoro-1-naphthoic acid; 4-fluoronaphthalene-1-carboxylic acid; 4-fluoronaphthalene-1-carboxylate; 4-Fluoro-1-naphthoicacid |
분자식 |
C11H6FO2 |
분자량 |
189.1631 |
InChI |
InChI=1/C11H7FO2/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6H,(H,13,14)/p-1 |
cas번호 |
573-03-5 |
EC번호 |
209-346-9 |
분자 구조 |
|
녹는 점 |
223-227℃ |
비등점 |
370.8°C at 760 mmHg |
인화점 |
178°C |
증기압 |
3.74E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|