ChemNet > CAS > 57319-65-0 6-amino-1,3-dihydroisobenzofuran-1-one
57319-65-0 6-amino-1,3-dihydroisobenzofuran-1-one
| 상품명칭 |
6-amino-1,3-dihydroisobenzofuran-1-one |
| 영문 이름 |
6-amino-1,3-dihydroisobenzofuran-1-one; 6-Aminophtalide; 6-amino-2-benzofuran-1(3H)-one |
| 분자식 |
C8H7NO2 |
| 분자량 |
149.1467 |
| InChI |
InChI=1/C8H7NO2/c9-6-2-1-5-4-11-8(10)7(5)3-6/h1-3H,4,9H2 |
| cas번호 |
57319-65-0 |
| EC번호 |
260-675-4 |
| 분자 구조 |
|
| 밀도 |
1.376g/cm3 |
| 녹는 점 |
182℃ |
| 비등점 |
420.2°C at 760 mmHg |
| 굴절 지수 |
1.655 |
| 인화점 |
248.3°C |
| 증기압 |
2.87E-07mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
